C16H23NO2 — CID 129050133
[(2E,4Z,5E)-4-(2-methylprop-2-enylidene)-5-[(Z)-prop-1-enyl]octa-2,5-dien-3-yl]carbamic acid (PubChem CID 129050133) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is [(2E,4Z,5E)-4-(2-methylprop-2-enylidene)-5-[(Z)-prop-1-enyl]octa-2,5-dien-3-yl]carbamic acid.
| Compound Name | [(2E,4Z,5E)-4-(2-methylprop-2-enylidene)-5-[(Z)-prop-1-enyl]octa-2,5-dien-3-yl]carbamic acid |
|---|---|
| PubChem CID | 129050133 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | [(2E,4Z,5E)-4-(2-methylprop-2-enylidene)-5-[(Z)-prop-1-enyl]octa-2,5-dien-3-yl]carbamic acid |
| SMILES | C=C(C)/C=C(C(/C=C\C)=C/CC)\C(=C/C)NC(=O)O |
| InChI | InChI=1S/C16H23NO2/c1-6-9-13(10-7-2)14(11-12(4)5)15(8-3)17-16(18)19/h6,8-11,17H,4,7H2,1-3,5H3,(H,18,19)/b9-6-,13-10+,14-11-,15-8+ |
| InChIKey | FPYPAPOXIGXJHY-YZXILONTSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|