C26H40N2O4 — CID 129050139
3-[2-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]ethoxy]-N-cyclopropyl-N-(2,2-dimethoxyethyl)propanamide (PubChem CID 129050139) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is 3-[2-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]ethoxy]-N-cyclopropyl-N-(2,2-dimethoxyethyl)propanamide.
| Compound Name | 3-[2-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]ethoxy]-N-cyclopropyl-N-(2,2-dimethoxyethyl)propanamide |
|---|---|
| PubChem CID | 129050139 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 3-[2-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenyl]ethoxy]-N-cyclopropyl-N-(2,2-dimethoxyethyl)propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1ccc(CN2CC3CCCC3C2)cc1)C1CC1)OC |
| InChI | InChI=1S/C26H40N2O4/c1-30-26(31-2)19-28(24-10-11-24)25(29)13-15-32-14-12-20-6-8-21(9-7-20)16-27-17-22-4-3-5-23(22)18-27/h6-9,22-24,26H,3-5,10-19H2,1-2H3 |
| InChIKey | SJDZFCNYIUETSU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|