C19H23N7 — CID 129050202
6-(cyclohexen-1-yl)-N-(5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 129050202) has the molecular formula C19H23N7 and a molecular weight of 349.44 g/mol. Its IUPAC name is 6-(cyclohexen-1-yl)-N-(5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | 6-(cyclohexen-1-yl)-N-(5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 129050202 |
| Molecular Formula | C19H23N7 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 6-(cyclohexen-1-yl)-N-(5-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | CN1CCn2nc(Nc3cc(C4=CCCCC4)cn4ncnc34)cc2C1 |
| InChI | InChI=1S/C19H23N7/c1-24-7-8-25-16(12-24)10-18(23-25)22-17-9-15(14-5-3-2-4-6-14)11-26-19(17)20-13-21-26/h5,9-11,13H,2-4,6-8,12H2,1H3,(H,22,23) |
| InChIKey | VRSREHCIPORFSY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |