C12H9N3OS — CID 129050561
1-[1-(1,3-benzothiazol-2-yl)pyrazol-4-yl]ethanone (PubChem CID 129050561) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is 1-[1-(1,3-benzothiazol-2-yl)pyrazol-4-yl]ethanone.
| Compound Name | 1-[1-(1,3-benzothiazol-2-yl)pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 129050561 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1-[1-(1,3-benzothiazol-2-yl)pyrazol-4-yl]ethanone |
| SMILES | CC(=O)c1cnn(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C12H9N3OS/c1-8(16)9-6-13-15(7-9)12-14-10-4-2-3-5-11(10)17-12/h2-7H,1H3 |
| InChIKey | JWFNUKJBALMGOX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |