About tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate
tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate (PubChem CID 129050647) has the molecular formula C24H28F3NO2
and a molecular weight of 419.49 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate.
Molecular Properties
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate |
| PubChem CID | 129050647 |
| Molecular Formula | C24H28F3NO2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCCC(F)(F)F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28F3NO2/c1-23(2,3)30-22(29)20(16-10-11-17-24(25,26)27)28-21(18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-9,12-15,20H,10-11,16-17H2,1-3H3 |
| InChIKey | VWNQJKFEOXXYTB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate?
The IUPAC name of tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate (CID 129050647) is tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate.
What is the SMILES notation for tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate?
The canonical SMILES for tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate is CC(C)(C)OC(=O)C(CCCCC(F)(F)F)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate?
The InChIKey is VWNQJKFEOXXYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28F3NO2/c1-23(2,3)30-22(29)20(16-10-11-17-24(25,26)27)28-21(18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-9,12-15,20H,10-11,16-17H2,1-3H3.
What are the key properties of tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate?
tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate has a molecular weight of 419.49 g/mol, XLogP of 6.36, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoate is sourced from PubChem (CID 129050647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).