C25H38N2O — CID 129051311
(2S)-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]pyrrolidine-2-carboxamide (PubChem CID 129051311) has the molecular formula C25H38N2O and a molecular weight of 382.59 g/mol. Its IUPAC name is (2S)-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129051311 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | (2S)-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]pyrrolidine-2-carboxamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/CNC(=O)[C@@H]2CCCN2)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H38N2O/c1-19(13-14-22-21(3)11-7-16-25(22,4)5)9-6-10-20(2)15-18-27-24(28)23-12-8-17-26-23/h6,9-10,13-15,23,26H,7-8,11-12,16-18H2,1-5H3,(H,27,28)/b10-6+,14-13+,19-9+,20-15+/t23-/m0/s1 |
| InChIKey | FXUOMJZMIDYCQN-BLXIEQATSA-N |
| XLogP | 5.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|