C10H21NO5 — CID 129051393
N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-methylhexyl]propanamide (PubChem CID 129051393) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-methylhexyl]propanamide.
| Compound Name | N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-methylhexyl]propanamide |
|---|---|
| PubChem CID | 129051393 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-2-methylhexyl]propanamide |
| SMILES | CCC(=O)NC[C@H](C)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H21NO5/c1-3-8(14)11-4-6(2)9(15)10(16)7(13)5-12/h6-7,9-10,12-13,15-16H,3-5H2,1-2H3,(H,11,14)/t6-,7+,9+,10+/m0/s1 |
| InChIKey | LXCVJXIOKQERKJ-MVHNUAHISA-N |
| XLogP | -1.78 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |