C21H17N3O2 — CID 129051992
4-(4,6-dimethyl-2-phenylpyrrolo[2,3-d]pyrimidin-7-yl)benzoic acid (PubChem CID 129051992) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-(4,6-dimethyl-2-phenylpyrrolo[2,3-d]pyrimidin-7-yl)benzoic acid.
| Compound Name | 4-(4,6-dimethyl-2-phenylpyrrolo[2,3-d]pyrimidin-7-yl)benzoic acid |
|---|---|
| PubChem CID | 129051992 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-(4,6-dimethyl-2-phenylpyrrolo[2,3-d]pyrimidin-7-yl)benzoic acid |
| SMILES | Cc1nc(-c2ccccc2)nc2c1cc(C)n2-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H17N3O2/c1-13-12-18-14(2)22-19(15-6-4-3-5-7-15)23-20(18)24(13)17-10-8-16(9-11-17)21(25)26/h3-12H,1-2H3,(H,25,26) |
| InChIKey | NVAGQBBBCZUYMK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |