C20H19FN6OS — CID 129052161
2-[2-(3H-benzimidazol-5-ylmethylamino)ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 129052161) has the molecular formula C20H19FN6OS and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-[2-(3H-benzimidazol-5-ylmethylamino)ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(3H-benzimidazol-5-ylmethylamino)ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129052161 |
| Molecular Formula | C20H19FN6OS |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[2-(3H-benzimidazol-5-ylmethylamino)ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ncccc1F)c1csc(CCNCc2ccc3nc[nH]c3c2)n1 |
| InChI | InChI=1S/C20H19FN6OS/c21-14-2-1-6-23-17(14)10-24-20(28)18-11-29-19(27-18)5-7-22-9-13-3-4-15-16(8-13)26-12-25-15/h1-4,6,8,11-12,22H,5,7,9-10H2,(H,24,28)(H,25,26) |
| InChIKey | KYPLYDIUXWOHIS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|