C20H18F2N6OS — CID 129052230
2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(3,5-difluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 129052230) has the molecular formula C20H18F2N6OS and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(3,5-difluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(3,5-difluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129052230 |
| Molecular Formula | C20H18F2N6OS |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(3,5-difluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ncc(F)cc1F)c1csc(CCNCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C20H18F2N6OS/c21-12-7-13(22)16(24-8-12)9-25-20(29)17-11-30-19(28-17)5-6-23-10-18-26-14-3-1-2-4-15(14)27-18/h1-4,7-8,11,23H,5-6,9-10H2,(H,25,29)(H,26,27) |
| InChIKey | DXSOTZLJJOKYBM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|