C19H21N7OS — CID 129052240
2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(3-methylimidazol-4-yl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 129052240) has the molecular formula C19H21N7OS and a molecular weight of 395.49 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(3-methylimidazol-4-yl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(3-methylimidazol-4-yl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129052240 |
| Molecular Formula | C19H21N7OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(3-methylimidazol-4-yl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cn1cncc1CNC(=O)c1csc(CCNCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C19H21N7OS/c1-26-12-21-8-13(26)9-22-19(27)16-11-28-18(25-16)6-7-20-10-17-23-14-4-2-3-5-15(14)24-17/h2-5,8,11-12,20H,6-7,9-10H2,1H3,(H,22,27)(H,23,24) |
| InChIKey | XNPVDCOHONBENW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|