C21H21N7O2S — CID 129052400
2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(6-carbamoyl-3-pyridinyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 129052400) has the molecular formula C21H21N7O2S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(6-carbamoyl-3-pyridinyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(6-carbamoyl-3-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129052400 |
| Molecular Formula | C21H21N7O2S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(6-carbamoyl-3-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1ccc(CNC(=O)c2csc(CCNCc3nc4ccccc4[nH]3)n2)cn1 |
| InChI | InChI=1S/C21H21N7O2S/c22-20(29)16-6-5-13(9-24-16)10-25-21(30)17-12-31-19(28-17)7-8-23-11-18-26-14-3-1-2-4-15(14)27-18/h1-6,9,12,23H,7-8,10-11H2,(H2,22,29)(H,25,30)(H,26,27) |
| InChIKey | IVKMHAXTGHCVDQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|