C20H23N7OS — CID 129052431
2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 129052431) has the molecular formula C20H23N7OS and a molecular weight of 409.52 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129052431 |
| Molecular Formula | C20H23N7OS |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-[(1,5-dimethylpyrazol-4-yl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1c(CNC(=O)c2csc(CCNCc3nc4ccccc4[nH]3)n2)cnn1C |
| InChI | InChI=1S/C20H23N7OS/c1-13-14(10-23-27(13)2)9-22-20(28)17-12-29-19(26-17)7-8-21-11-18-24-15-5-3-4-6-16(15)25-18/h3-6,10,12,21H,7-9,11H2,1-2H3,(H,22,28)(H,24,25) |
| InChIKey | QWVIXWBIZXRKRL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|