C14H22S — CID 129052591
1,3,5,5,7-pentamethyl-4,6,7,8-tetrahydrocyclohepta[c]thiophene (PubChem CID 129052591) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 1,3,5,5,7-pentamethyl-4,6,7,8-tetrahydrocyclohepta[c]thiophene.
| Compound Name | 1,3,5,5,7-pentamethyl-4,6,7,8-tetrahydrocyclohepta[c]thiophene |
|---|---|
| PubChem CID | 129052591 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1,3,5,5,7-pentamethyl-4,6,7,8-tetrahydrocyclohepta[c]thiophene |
| SMILES | Cc1sc(C)c2c1CC(C)CC(C)(C)C2 |
| InChI | InChI=1S/C14H22S/c1-9-6-12-10(2)15-11(3)13(12)8-14(4,5)7-9/h9H,6-8H2,1-5H3 |
| InChIKey | YETBRJBBPYZARK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |