C18H18N6O2S — CID 129052692
2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-(1,3-oxazol-2-ylmethyl)-1,3-thiazole-4-carboxamide (PubChem CID 129052692) has the molecular formula C18H18N6O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-(1,3-oxazol-2-ylmethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-(1,3-oxazol-2-ylmethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129052692 |
| Molecular Formula | C18H18N6O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-ylmethylamino)ethyl]-N-(1,3-oxazol-2-ylmethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ncco1)c1csc(CCNCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C18H18N6O2S/c25-18(21-10-16-20-7-8-26-16)14-11-27-17(24-14)5-6-19-9-15-22-12-3-1-2-4-13(12)23-15/h1-4,7-8,11,19H,5-6,9-10H2,(H,21,25)(H,22,23) |
| InChIKey | KQGPYGJDFWZUIP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|