C20H18FN5O2S — CID 129052829
2-[2-(1,3-benzoxazol-2-ylmethylamino)ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 129052829) has the molecular formula C20H18FN5O2S and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[2-(1,3-benzoxazol-2-ylmethylamino)ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-(1,3-benzoxazol-2-ylmethylamino)ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129052829 |
| Molecular Formula | C20H18FN5O2S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[2-(1,3-benzoxazol-2-ylmethylamino)ethyl]-N-[(3-fluoro-2-pyridinyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ncccc1F)c1csc(CCNCc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C20H18FN5O2S/c21-13-4-3-8-23-15(13)10-24-20(27)16-12-29-19(26-16)7-9-22-11-18-25-14-5-1-2-6-17(14)28-18/h1-6,8,12,22H,7,9-11H2,(H,24,27) |
| InChIKey | CIDPMUPSCBQMES-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|