C17H17ClN4O2 — CID 129053223
6-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-2,3-dihydroisoindol-1-one (PubChem CID 129053223) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 6-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 6-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 129053223 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 6-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2ccc(-c3nc(NC4CCOCC4)ncc3Cl)cc21 |
| InChI | InChI=1S/C17H17ClN4O2/c18-14-9-20-17(21-12-3-5-24-6-4-12)22-15(14)10-1-2-11-8-19-16(23)13(11)7-10/h1-2,7,9,12H,3-6,8H2,(H,19,23)(H,20,21,22) |
| InChIKey | GIZKBEAJKWOWLS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |