About 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane
10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane (PubChem CID 129053806) has the molecular formula C20H32N2O
and a molecular weight of 316.49 g/mol. Its IUPAC name is 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane |
| PubChem CID | 129053806 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane |
| SMILES | CCN1CC(C)(C)OC2(CCCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C20H32N2O/c1-4-21-16-19(2,3)23-20(17-21)11-8-13-22(14-12-20)15-18-9-6-5-7-10-18/h5-7,9-10H,4,8,11-17H2,1-3H3 |
| InChIKey | DDXWEXQXHKHAOS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane?
The IUPAC name of 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane (CID 129053806) is 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane.
What is the SMILES notation for 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane?
The canonical SMILES for 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane is CCN1CC(C)(C)OC2(CCCN(Cc3ccccc3)CC2)C1.
What is the InChIKey of 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane?
The InChIKey is DDXWEXQXHKHAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N2O/c1-4-21-16-19(2,3)23-20(17-21)11-8-13-22(14-12-20)15-18-9-6-5-7-10-18/h5-7,9-10H,4,8,11-17H2,1-3H3.
What are the key properties of 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane?
10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane has a molecular weight of 316.49 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-benzyl-4-ethyl-2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane is sourced from PubChem (CID 129053806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).