C14H11BrN2O — CID 129053974
(6-bromoimidazo[1,2-a]pyridin-3-yl)-phenylmethanol (PubChem CID 129053974) has the molecular formula C14H11BrN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is (6-bromoimidazo[1,2-a]pyridin-3-yl)-phenylmethanol.
| Compound Name | (6-bromoimidazo[1,2-a]pyridin-3-yl)-phenylmethanol |
|---|---|
| PubChem CID | 129053974 |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | (6-bromoimidazo[1,2-a]pyridin-3-yl)-phenylmethanol |
| SMILES | OC(c1ccccc1)c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C14H11BrN2O/c15-11-6-7-13-16-8-12(17(13)9-11)14(18)10-4-2-1-3-5-10/h1-9,14,18H |
| InChIKey | LZVDHBHZWRMXTQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |