C25H31NO2 — CID 129054492
(Z)-4-[[4,5-dimethyl-2-(2,3,5-trimethylphenyl)-2H-quinolin-1-yl]oxy]pent-3-en-2-ol (PubChem CID 129054492) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is (Z)-4-[[4,5-dimethyl-2-(2,3,5-trimethylphenyl)-2H-quinolin-1-yl]oxy]pent-3-en-2-ol.
| Compound Name | (Z)-4-[[4,5-dimethyl-2-(2,3,5-trimethylphenyl)-2H-quinolin-1-yl]oxy]pent-3-en-2-ol |
|---|---|
| PubChem CID | 129054492 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | (Z)-4-[[4,5-dimethyl-2-(2,3,5-trimethylphenyl)-2H-quinolin-1-yl]oxy]pent-3-en-2-ol |
| SMILES | CC1=CC(c2cc(C)cc(C)c2C)N(O/C(C)=C\C(C)O)c2cccc(C)c21 |
| InChI | InChI=1S/C25H31NO2/c1-15-11-17(3)21(7)22(12-15)24-13-18(4)25-16(2)9-8-10-23(25)26(24)28-20(6)14-19(5)27/h8-14,19,24,27H,1-7H3/b20-14- |
| InChIKey | MBOQCYWRUUZVTA-ZHZULCJRSA-N |
| XLogP | 6.10 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|