C9H9F9O2S — CID 12905479
3-methyl-1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)but-2-ene (PubChem CID 12905479) has the molecular formula C9H9F9O2S and a molecular weight of 352.22 g/mol. Its IUPAC name is 3-methyl-1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)but-2-ene.
| Compound Name | 3-methyl-1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)but-2-ene |
|---|---|
| PubChem CID | 12905479 |
| Molecular Formula | C9H9F9O2S |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 3-methyl-1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)but-2-ene |
| SMILES | CC(C)=CCS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9O2S/c1-5(2)3-4-21(19,20)9(17,18)7(12,13)6(10,11)8(14,15)16/h3H,4H2,1-2H3 |
| InChIKey | QMQGEZZXBOVHRB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|