About (2Z,4Z)-2-aminohepta-2,4-dien-3-ol
(2Z,4Z)-2-aminohepta-2,4-dien-3-ol (PubChem CID 129054924) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is (2Z,4Z)-2-aminohepta-2,4-dien-3-ol.
Molecular Properties
| Compound Name | (2Z,4Z)-2-aminohepta-2,4-dien-3-ol |
| PubChem CID | 129054924 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (2Z,4Z)-2-aminohepta-2,4-dien-3-ol |
| SMILES | CC/C=C\C(O)=C(/C)N |
| InChI | InChI=1S/C7H13NO/c1-3-4-5-7(9)6(2)8/h4-5,9H,3,8H2,1-2H3/b5-4-,7-6- |
| InChIKey | KWKVKLJWHYCFCO-RZSVFLSASA-N |
| XLogP | 1.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-aminohepta-2,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-aminohepta-2,4-dien-3-ol?
The IUPAC name of (2Z,4Z)-2-aminohepta-2,4-dien-3-ol (CID 129054924) is (2Z,4Z)-2-aminohepta-2,4-dien-3-ol.
What is the SMILES notation for (2Z,4Z)-2-aminohepta-2,4-dien-3-ol?
The canonical SMILES for (2Z,4Z)-2-aminohepta-2,4-dien-3-ol is CC/C=C\C(O)=C(/C)N.
What is the InChIKey of (2Z,4Z)-2-aminohepta-2,4-dien-3-ol?
The InChIKey is KWKVKLJWHYCFCO-RZSVFLSASA-N. The full InChI is InChI=1S/C7H13NO/c1-3-4-5-7(9)6(2)8/h4-5,9H,3,8H2,1-2H3/b5-4-,7-6-.
What are the key properties of (2Z,4Z)-2-aminohepta-2,4-dien-3-ol?
(2Z,4Z)-2-aminohepta-2,4-dien-3-ol has a molecular weight of 127.19 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-aminohepta-2,4-dien-3-ol is sourced from PubChem (CID 129054924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).