C22H36N2O3 — CID 129055302
tert-butyl N-[[1-[1-(3-methoxyphenyl)-2-methylpropan-2-yl]piperidin-4-yl]methyl]carbamate (PubChem CID 129055302) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is tert-butyl N-[[1-[1-(3-methoxyphenyl)-2-methylpropan-2-yl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[1-(3-methoxyphenyl)-2-methylpropan-2-yl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 129055302 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | tert-butyl N-[[1-[1-(3-methoxyphenyl)-2-methylpropan-2-yl]piperidin-4-yl]methyl]carbamate |
| SMILES | COc1cccc(CC(C)(C)N2CCC(CNC(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C22H36N2O3/c1-21(2,3)27-20(25)23-16-17-10-12-24(13-11-17)22(4,5)15-18-8-7-9-19(14-18)26-6/h7-9,14,17H,10-13,15-16H2,1-6H3,(H,23,25) |
| InChIKey | VQNVVVMFGCFXFB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |