About 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid
3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid (PubChem CID 129055388) has the molecular formula C10H16F3NO6S
and a molecular weight of 335.30 g/mol. Its IUPAC name is 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid |
| PubChem CID | 129055388 |
| Molecular Formula | C10H16F3NO6S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid |
| SMILES | O=C(CC(F)(F)F)OC(CN1CCOCC1)CS(=O)(=O)O |
| InChI | InChI=1S/C10H16F3NO6S/c11-10(12,13)5-9(15)20-8(7-21(16,17)18)6-14-1-3-19-4-2-14/h8H,1-7H2,(H,16,17,18) |
| InChIKey | ZAKILQASEVCVSX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid?
The IUPAC name of 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid (CID 129055388) is 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid.
What is the SMILES notation for 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid?
The canonical SMILES for 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid is O=C(CC(F)(F)F)OC(CN1CCOCC1)CS(=O)(=O)O.
What is the InChIKey of 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid?
The InChIKey is ZAKILQASEVCVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO6S/c11-10(12,13)5-9(15)20-8(7-21(16,17)18)6-14-1-3-19-4-2-14/h8H,1-7H2,(H,16,17,18).
What are the key properties of 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid?
3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid has a molecular weight of 335.30 g/mol, XLogP of 0.07, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-yl-2-(3,3,3-trifluoropropanoyloxy)propane-1-sulfonic acid is sourced from PubChem (CID 129055388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).