About (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine
(Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine (PubChem CID 129055454) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine.
Molecular Properties
| Compound Name | (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine |
| PubChem CID | 129055454 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine |
| SMILES | C/C=C(\C=C/CCC)CN(C)C |
| InChI | InChI=1S/C11H21N/c1-5-7-8-9-11(6-2)10-12(3)4/h6,8-9H,5,7,10H2,1-4H3/b9-8-,11-6+ |
| InChIKey | QMOOROLMHTWWLK-XSONURMYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine?
The IUPAC name of (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine (CID 129055454) is (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine.
What is the SMILES notation for (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine?
The canonical SMILES for (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine is C/C=C(\C=C/CCC)CN(C)C.
What is the InChIKey of (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine?
The InChIKey is QMOOROLMHTWWLK-XSONURMYSA-N. The full InChI is InChI=1S/C11H21N/c1-5-7-8-9-11(6-2)10-12(3)4/h6,8-9H,5,7,10H2,1-4H3/b9-8-,11-6+.
What are the key properties of (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine?
(Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine has a molecular weight of 167.30 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2E)-2-ethylidene-N,N-dimethylhept-3-en-1-amine is sourced from PubChem (CID 129055454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).