C22H35N3 — CID 129055603
2-N-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]-3-N-[2-[[(3Z)-5-methylhexa-1,3,5-trien-2-yl]amino]ethyl]but-1-ene-2,3-diamine (PubChem CID 129055603) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 2-N-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]-3-N-[2-[[(3Z)-5-methylhexa-1,3,5-trien-2-yl]amino]ethyl]but-1-ene-2,3-diamine.
| Compound Name | 2-N-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]-3-N-[2-[[(3Z)-5-methylhexa-1,3,5-trien-2-yl]amino]ethyl]but-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 129055603 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 2-N-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]-3-N-[2-[[(3Z)-5-methylhexa-1,3,5-trien-2-yl]amino]ethyl]but-1-ene-2,3-diamine |
| SMILES | C=C/C(=C\C=C(C)C)CNC(=C)C(C)NCCNC(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C22H35N3/c1-9-22(13-11-18(4)5)16-25-21(8)20(7)24-15-14-23-19(6)12-10-17(2)3/h9-13,20,23-25H,1-2,6,8,14-16H2,3-5,7H3/b12-10-,22-13+ |
| InChIKey | IDIBNNALYFTHAL-HSKYVWOFSA-N |
| XLogP | 4.38 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|