C20H26F2N2O — CID 129055915
(2E)-3-(difluoromethyl)-2-(dimethylaminomethylidene)-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)but-3-enamide (PubChem CID 129055915) has the molecular formula C20H26F2N2O and a molecular weight of 348.44 g/mol. Its IUPAC name is (2E)-3-(difluoromethyl)-2-(dimethylaminomethylidene)-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)but-3-enamide.
| Compound Name | (2E)-3-(difluoromethyl)-2-(dimethylaminomethylidene)-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)but-3-enamide |
|---|---|
| PubChem CID | 129055915 |
| Molecular Formula | C20H26F2N2O |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2E)-3-(difluoromethyl)-2-(dimethylaminomethylidene)-N-(1,1,3-trimethyl-2,3-dihydroinden-4-yl)but-3-enamide |
| SMILES | C=C(/C(=C\N(C)C)C(=O)Nc1cccc2c1C(C)CC2(C)C)C(F)F |
| InChI | InChI=1S/C20H26F2N2O/c1-12-10-20(3,4)15-8-7-9-16(17(12)15)23-19(25)14(11-24(5)6)13(2)18(21)22/h7-9,11-12,18H,2,10H2,1,3-6H3,(H,23,25)/b14-11+ |
| InChIKey | YXBCOXYRAXULQG-SDNWHVSQSA-N |
| XLogP | 4.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|