C27H29FN6O3 — CID 129056012
(E)-4-[(2-fluoro-3,5-dimethoxy-N-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-2-yl]anilino)methyl]hex-4-enamide (PubChem CID 129056012) has the molecular formula C27H29FN6O3 and a molecular weight of 504.57 g/mol. Its IUPAC name is (E)-4-[(2-fluoro-3,5-dimethoxy-N-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-2-yl]anilino)methyl]hex-4-enamide.
| Compound Name | (E)-4-[(2-fluoro-3,5-dimethoxy-N-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-2-yl]anilino)methyl]hex-4-enamide |
|---|---|
| PubChem CID | 129056012 |
| Molecular Formula | C27H29FN6O3 |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | (E)-4-[(2-fluoro-3,5-dimethoxy-N-[7-(1-methylpyrazol-4-yl)-1,5-naphthyridin-2-yl]anilino)methyl]hex-4-enamide |
| SMILES | C/C=C(\CCC(N)=O)CN(c1ccc2ncc(-c3cnn(C)c3)cc2n1)c1cc(OC)cc(OC)c1F |
| InChI | InChI=1S/C27H29FN6O3/c1-5-17(6-8-25(29)35)15-34(23-11-20(36-3)12-24(37-4)27(23)28)26-9-7-21-22(32-26)10-18(13-30-21)19-14-31-33(2)16-19/h5,7,9-14,16H,6,8,15H2,1-4H3,(H2,29,35)/b17-5+ |
| InChIKey | ULXVVXJQLGOXON-YAXRCOADSA-N |
| XLogP | 4.54 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|