C18H28N2S — CID 129056015
1-[6-(4,6-dimethylcyclohexa-2,4-dien-1-yl)sulfanylcyclohex-2-en-1-yl]piperazine (PubChem CID 129056015) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-[6-(4,6-dimethylcyclohexa-2,4-dien-1-yl)sulfanylcyclohex-2-en-1-yl]piperazine.
| Compound Name | 1-[6-(4,6-dimethylcyclohexa-2,4-dien-1-yl)sulfanylcyclohex-2-en-1-yl]piperazine |
|---|---|
| PubChem CID | 129056015 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-[6-(4,6-dimethylcyclohexa-2,4-dien-1-yl)sulfanylcyclohex-2-en-1-yl]piperazine |
| SMILES | CC1=CC(C)C(SC2CCC=CC2N2CCNCC2)C=C1 |
| InChI | InChI=1S/C18H28N2S/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20/h3,5,7-8,13,15-19H,4,6,9-12H2,1-2H3 |
| InChIKey | DZKVIFBSYWBSMJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|