About (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine
(2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine (PubChem CID 129056819) has the molecular formula C15H19Cl2N3O
and a molecular weight of 328.24 g/mol. Its IUPAC name is (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine.
Molecular Properties
| Compound Name | (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine |
| PubChem CID | 129056819 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine |
| SMILES | Clc1ccc(NN2C[C@]3(CC4CCC3CC4)ON2)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O/c16-13-6-5-12(7-14(13)17)18-20-9-15(21-19-20)8-10-1-3-11(15)4-2-10/h5-7,10-11,18-19H,1-4,8-9H2/t10?,11?,15-/m0/s1 |
| InChIKey | CBICKVBOKYLSLM-NWHVRFAMSA-N |
| XLogP | 4.02 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine?
The IUPAC name of (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine (CID 129056819) is (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine.
What is the SMILES notation for (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine?
The canonical SMILES for (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine is Clc1ccc(NN2C[C@]3(CC4CCC3CC4)ON2)cc1Cl.
What is the InChIKey of (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine?
The InChIKey is CBICKVBOKYLSLM-NWHVRFAMSA-N. The full InChI is InChI=1S/C15H19Cl2N3O/c16-13-6-5-12(7-14(13)17)18-20-9-15(21-19-20)8-10-1-3-11(15)4-2-10/h5-7,10-11,18-19H,1-4,8-9H2/t10?,11?,15-/m0/s1.
What are the key properties of (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine?
(2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine has a molecular weight of 328.24 g/mol, XLogP of 4.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(3,4-dichlorophenyl)spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine is sourced from PubChem (CID 129056819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).