About 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid
2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid (PubChem CID 129057255) has the molecular formula C20H20F3NO2
and a molecular weight of 363.38 g/mol. Its IUPAC name is 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid.
Molecular Properties
| Compound Name | 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid |
| PubChem CID | 129057255 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid |
| SMILES | O=C(O)C(CCCCC(F)(F)F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20F3NO2/c21-20(22,23)14-8-7-13-17(19(25)26)24-18(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-6,9-12,17H,7-8,13-14H2,(H,25,26) |
| InChIKey | VESWKKHOKSZWJB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid?
The IUPAC name of 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid (CID 129057255) is 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid.
What is the SMILES notation for 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid?
The canonical SMILES for 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid is O=C(O)C(CCCCC(F)(F)F)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid?
The InChIKey is VESWKKHOKSZWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3NO2/c21-20(22,23)14-8-7-13-17(19(25)26)24-18(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-6,9-12,17H,7-8,13-14H2,(H,25,26).
What are the key properties of 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid?
2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid has a molecular weight of 363.38 g/mol, XLogP of 5.10, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzhydrylideneamino)-7,7,7-trifluoroheptanoic acid is sourced from PubChem (CID 129057255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).