C36H30FN7O3 — CID 129057691
3-[5-[[(11R,15S)-5-anilino-8-methyl-7-oxo-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-4-yl]methyl]-2-(6-fluoro-2-pyridinyl)phenyl]benzoic acid (PubChem CID 129057691) has the molecular formula C36H30FN7O3 and a molecular weight of 627.68 g/mol. Its IUPAC name is 3-[5-[[(11R,15S)-5-anilino-8-methyl-7-oxo-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-4-yl]methyl]-2-(6-fluoro-2-pyridinyl)phenyl]benzoic acid.
| Compound Name | 3-[5-[[(11R,15S)-5-anilino-8-methyl-7-oxo-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-4-yl]methyl]-2-(6-fluoro-2-pyridinyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 129057691 |
| Molecular Formula | C36H30FN7O3 |
| Molecular Weight | 627.68 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 3-[5-[[(11R,15S)-5-anilino-8-methyl-7-oxo-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-4-yl]methyl]-2-(6-fluoro-2-pyridinyl)phenyl]benzoic acid |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4cccc(F)n4)c(-c4cccc(C(=O)O)c4)c3)c2Nc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C36H30FN7O3/c1-42-34(45)31-32(38-24-10-3-2-4-11-24)43(41-33(31)44-29-14-6-13-28(29)40-36(42)44)20-21-16-17-25(27-12-7-15-30(37)39-27)26(18-21)22-8-5-9-23(19-22)35(46)47/h2-5,7-12,15-19,28-29,38H,6,13-14,20H2,1H3,(H,46,47)/t28-,29+/m1/s1 |
| InChIKey | CWZTXFYVEJWPNQ-WDYNHAJCSA-N |
| XLogP | 6.42 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|