About 2,5,7-trimethyl-4a,5-dihydroquinoline
2,5,7-trimethyl-4a,5-dihydroquinoline (PubChem CID 129057867) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2,5,7-trimethyl-4a,5-dihydroquinoline.
Molecular Properties
| Compound Name | 2,5,7-trimethyl-4a,5-dihydroquinoline |
| PubChem CID | 129057867 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2,5,7-trimethyl-4a,5-dihydroquinoline |
| SMILES | CC1=CC(C)C2C=CC(C)=NC2=C1 |
| InChI | InChI=1S/C12H15N/c1-8-6-9(2)11-5-4-10(3)13-12(11)7-8/h4-7,9,11H,1-3H3 |
| InChIKey | DRCIXMQEHPWBCL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5,7-trimethyl-4a,5-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,7-trimethyl-4a,5-dihydroquinoline?
The IUPAC name of 2,5,7-trimethyl-4a,5-dihydroquinoline (CID 129057867) is 2,5,7-trimethyl-4a,5-dihydroquinoline.
What is the SMILES notation for 2,5,7-trimethyl-4a,5-dihydroquinoline?
The canonical SMILES for 2,5,7-trimethyl-4a,5-dihydroquinoline is CC1=CC(C)C2C=CC(C)=NC2=C1.
What is the InChIKey of 2,5,7-trimethyl-4a,5-dihydroquinoline?
The InChIKey is DRCIXMQEHPWBCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-8-6-9(2)11-5-4-10(3)13-12(11)7-8/h4-7,9,11H,1-3H3.
What are the key properties of 2,5,7-trimethyl-4a,5-dihydroquinoline?
2,5,7-trimethyl-4a,5-dihydroquinoline has a molecular weight of 173.26 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,7-trimethyl-4a,5-dihydroquinoline is sourced from PubChem (CID 129057867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).