About methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide
methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide (PubChem CID 12905787) has the molecular formula C6H9BrN2O2S
and a molecular weight of 253.12 g/mol. Its IUPAC name is methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide.
Molecular Properties
| Compound Name | methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide |
| PubChem CID | 12905787 |
| Molecular Formula | C6H9BrN2O2S |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide |
| SMILES | COC(=O)C[n+]1ccsc1N.[Br-] |
| InChI | InChI=1S/C6H8N2O2S.BrH/c1-10-5(9)4-8-2-3-11-6(8)7;/h2-3,7H,4H2,1H3;1H |
| InChIKey | JCWDWGMLWXAQSR-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide?
The IUPAC name of methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide (CID 12905787) is methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide.
What is the SMILES notation for methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide?
The canonical SMILES for methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide is COC(=O)C[n+]1ccsc1N.[Br-].
What is the InChIKey of methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide?
The InChIKey is JCWDWGMLWXAQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S.BrH/c1-10-5(9)4-8-2-3-11-6(8)7;/h2-3,7H,4H2,1H3;1H.
What are the key properties of methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide?
methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide has a molecular weight of 253.12 g/mol, XLogP of -3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate bromide is sourced from PubChem (CID 12905787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).