About methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate
methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate (PubChem CID 12905788) has the molecular formula C6H9N2O2S+
and a molecular weight of 173.22 g/mol. Its IUPAC name is methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate |
| PubChem CID | 12905788 |
| Molecular Formula | C6H9N2O2S+ |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate |
| SMILES | COC(=O)C[n+]1ccsc1N |
| InChI | InChI=1S/C6H8N2O2S/c1-10-5(9)4-8-2-3-11-6(8)7/h2-3,7H,4H2,1H3/p+1 |
| InChIKey | WJKREBQHDSHCGA-UHFFFAOYSA-O |
| XLogP | -0.21 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate?
The IUPAC name of methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate (CID 12905788) is methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate.
What is the SMILES notation for methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate?
The canonical SMILES for methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate is COC(=O)C[n+]1ccsc1N.
What is the InChIKey of methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate?
The InChIKey is WJKREBQHDSHCGA-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H8N2O2S/c1-10-5(9)4-8-2-3-11-6(8)7/h2-3,7H,4H2,1H3/p+1.
What are the key properties of methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate?
methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate has a molecular weight of 173.22 g/mol, XLogP of -0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-amino-1,3-thiazol-3-ium-3-yl)acetate is sourced from PubChem (CID 12905788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).