About 4,6-dimethyl-4a,5-dihydroquinazoline
4,6-dimethyl-4a,5-dihydroquinazoline (PubChem CID 129058049) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 4,6-dimethyl-4a,5-dihydroquinazoline.
Molecular Properties
| Compound Name | 4,6-dimethyl-4a,5-dihydroquinazoline |
| PubChem CID | 129058049 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4,6-dimethyl-4a,5-dihydroquinazoline |
| SMILES | CC1=CC=C2N=CN=C(C)C2C1 |
| InChI | InChI=1S/C10H12N2/c1-7-3-4-10-9(5-7)8(2)11-6-12-10/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | NHJNFHVEGWGLJJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dimethyl-4a,5-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-4a,5-dihydroquinazoline?
The IUPAC name of 4,6-dimethyl-4a,5-dihydroquinazoline (CID 129058049) is 4,6-dimethyl-4a,5-dihydroquinazoline.
What is the SMILES notation for 4,6-dimethyl-4a,5-dihydroquinazoline?
The canonical SMILES for 4,6-dimethyl-4a,5-dihydroquinazoline is CC1=CC=C2N=CN=C(C)C2C1.
What is the InChIKey of 4,6-dimethyl-4a,5-dihydroquinazoline?
The InChIKey is NHJNFHVEGWGLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-3-4-10-9(5-7)8(2)11-6-12-10/h3-4,6,9H,5H2,1-2H3.
What are the key properties of 4,6-dimethyl-4a,5-dihydroquinazoline?
4,6-dimethyl-4a,5-dihydroquinazoline has a molecular weight of 160.22 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-4a,5-dihydroquinazoline is sourced from PubChem (CID 129058049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).