C20H30N2O2 — CID 129058066
3-[5-[(1R)-2-(cyclopropylmethyl)cyclopropyl]pentyl]-1,2,3,4-tetrahydroquinoxaline-2,7-diol (PubChem CID 129058066) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3-[5-[(1R)-2-(cyclopropylmethyl)cyclopropyl]pentyl]-1,2,3,4-tetrahydroquinoxaline-2,7-diol.
| Compound Name | 3-[5-[(1R)-2-(cyclopropylmethyl)cyclopropyl]pentyl]-1,2,3,4-tetrahydroquinoxaline-2,7-diol |
|---|---|
| PubChem CID | 129058066 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 3-[5-[(1R)-2-(cyclopropylmethyl)cyclopropyl]pentyl]-1,2,3,4-tetrahydroquinoxaline-2,7-diol |
| SMILES | Oc1ccc2c(c1)NC(O)C(CCCCC[C@@H]1CC1CC1CC1)N2 |
| InChI | InChI=1S/C20H30N2O2/c23-16-8-9-17-19(12-16)22-20(24)18(21-17)5-3-1-2-4-14-11-15(14)10-13-6-7-13/h8-9,12-15,18,20-24H,1-7,10-11H2/t14-,15?,18?,20?/m1/s1 |
| InChIKey | ORMAISHZJMHMGW-JRWAHFEXSA-N |
| XLogP | 4.30 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|