C22H32N2 — CID 129058452
(5Z)-N-methyl-5-[(Z)-3-(2-methyl-3,4,5,6-tetrahydroquinolin-7-yl)prop-1-enyl]octa-5,7-dien-1-amine (PubChem CID 129058452) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is (5Z)-N-methyl-5-[(Z)-3-(2-methyl-3,4,5,6-tetrahydroquinolin-7-yl)prop-1-enyl]octa-5,7-dien-1-amine.
| Compound Name | (5Z)-N-methyl-5-[(Z)-3-(2-methyl-3,4,5,6-tetrahydroquinolin-7-yl)prop-1-enyl]octa-5,7-dien-1-amine |
|---|---|
| PubChem CID | 129058452 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | (5Z)-N-methyl-5-[(Z)-3-(2-methyl-3,4,5,6-tetrahydroquinolin-7-yl)prop-1-enyl]octa-5,7-dien-1-amine |
| SMILES | C=C/C=C(\C=C/CC1=CC2=C(CC1)CCC(C)=N2)CCCCNC |
| InChI | InChI=1S/C22H32N2/c1-4-8-19(9-5-6-16-23-3)10-7-11-20-13-15-21-14-12-18(2)24-22(21)17-20/h4,7-8,10,17,23H,1,5-6,9,11-16H2,2-3H3/b10-7-,19-8- |
| InChIKey | WUOQTXMJSZJOKR-CPCULQLXSA-N |
| XLogP | 5.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|