C26H30FN5O4 — CID 129058496
ethyl 4-[2-(aminodiazenyl)-4-[3-hydroxypropyl(propyl)carbamoyl]-3H-1-benzazepin-8-yl]-2-fluorobenzoate (PubChem CID 129058496) has the molecular formula C26H30FN5O4 and a molecular weight of 495.56 g/mol. Its IUPAC name is ethyl 4-[2-(aminodiazenyl)-4-[3-hydroxypropyl(propyl)carbamoyl]-3H-1-benzazepin-8-yl]-2-fluorobenzoate.
| Compound Name | ethyl 4-[2-(aminodiazenyl)-4-[3-hydroxypropyl(propyl)carbamoyl]-3H-1-benzazepin-8-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 129058496 |
| Molecular Formula | C26H30FN5O4 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | ethyl 4-[2-(aminodiazenyl)-4-[3-hydroxypropyl(propyl)carbamoyl]-3H-1-benzazepin-8-yl]-2-fluorobenzoate |
| SMILES | CCCN(CCCO)C(=O)C1=Cc2ccc(-c3ccc(C(=O)OCC)c(F)c3)cc2N=C(/N=N/N)C1 |
| InChI | InChI=1S/C26H30FN5O4/c1-3-10-32(11-5-12-33)25(34)20-13-19-7-6-18(15-23(19)29-24(16-20)30-31-28)17-8-9-21(22(27)14-17)26(35)36-4-2/h6-9,13-15,33H,3-5,10-12,16H2,1-2H3,(H2,28,29,30) |
| InChIKey | GNJHPGGSGOPYLZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|