C21H24N2 — CID 129058528
4-ethenyl-7-[(1E,3Z)-2-(4-ethenylcyclohexa-1,5-dien-1-yl)penta-1,3-dienyl]-3H-azepin-2-amine (PubChem CID 129058528) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-ethenyl-7-[(1E,3Z)-2-(4-ethenylcyclohexa-1,5-dien-1-yl)penta-1,3-dienyl]-3H-azepin-2-amine.
| Compound Name | 4-ethenyl-7-[(1E,3Z)-2-(4-ethenylcyclohexa-1,5-dien-1-yl)penta-1,3-dienyl]-3H-azepin-2-amine |
|---|---|
| PubChem CID | 129058528 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 4-ethenyl-7-[(1E,3Z)-2-(4-ethenylcyclohexa-1,5-dien-1-yl)penta-1,3-dienyl]-3H-azepin-2-amine |
| SMILES | C=CC1=CC=C(/C=C(\C=C/C)C2=CCC(C=C)C=C2)N=C(N)C1 |
| InChI | InChI=1S/C21H24N2/c1-4-7-19(18-11-8-16(5-2)9-12-18)15-20-13-10-17(6-3)14-21(22)23-20/h4-8,10-13,15-16H,2-3,9,14H2,1H3,(H2,22,23)/b7-4-,19-15+ |
| InChIKey | OYQOTUPLBNVHNZ-XDMYZPJXSA-N |
| XLogP | 4.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|