C25H19N5O2 — CID 129058608
N-[5-[9-(1,5-dihydropyrazol-2-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-ynamide (PubChem CID 129058608) has the molecular formula C25H19N5O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[5-[9-(1,5-dihydropyrazol-2-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-ynamide.
| Compound Name | N-[5-[9-(1,5-dihydropyrazol-2-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 129058608 |
| Molecular Formula | C25H19N5O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[5-[9-(1,5-dihydropyrazol-2-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-ynamide |
| SMILES | C#CC(=O)Nc1cc(-n2c(=O)ccc3cnc4ccc(N5C=CCN5)cc4c32)ccc1C |
| InChI | InChI=1S/C25H19N5O2/c1-3-23(31)28-22-14-19(7-5-16(22)2)30-24(32)10-6-17-15-26-21-9-8-18(13-20(21)25(17)30)29-12-4-11-27-29/h1,4-10,12-15,27H,11H2,2H3,(H,28,31) |
| InChIKey | CIXCKWJUKOPWMW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|