C27H31N3O4 — CID 129059193
(E)-3-[(1S,2S,10R,15S)-11-(cyclopropylmethyl)-5,15-dihydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]-2-methyl-N-pyridin-4-ylprop-2-enamide (PubChem CID 129059193) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is (E)-3-[(1S,2S,10R,15S)-11-(cyclopropylmethyl)-5,15-dihydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]-2-methyl-N-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-3-[(1S,2S,10R,15S)-11-(cyclopropylmethyl)-5,15-dihydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]-2-methyl-N-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 129059193 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (E)-3-[(1S,2S,10R,15S)-11-(cyclopropylmethyl)-5,15-dihydroxy-15-methyl-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]-2-methyl-N-pyridin-4-ylprop-2-enamide |
| SMILES | C/C(=C\[C@@H]1Oc2c(O)ccc3c2[C@@]12CCN(CC1CC1)[C@H](C3)[C@@]2(C)O)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C27H31N3O4/c1-16(25(32)29-19-7-10-28-11-8-19)13-22-27-9-12-30(15-17-3-4-17)21(26(27,2)33)14-18-5-6-20(31)24(34-22)23(18)27/h5-8,10-11,13,17,21-22,31,33H,3-4,9,12,14-15H2,1-2H3,(H,28,29,32)/b16-13+/t21-,22+,26-,27-/m1/s1 |
| InChIKey | NLHFGCHBNRIXSY-JGPXUHKVSA-N |
| XLogP | 3.16 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|