About 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine
2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine (PubChem CID 129059279) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine.
Molecular Properties
| Compound Name | 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine |
| PubChem CID | 129059279 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine |
| SMILES | [H]/N=C(/CC1CN=C(C)N1C)N1CCCCC1 |
| InChI | InChI=1S/C12H22N4/c1-10-14-9-11(15(10)2)8-12(13)16-6-4-3-5-7-16/h11,13H,3-9H2,1-2H3/b13-12- |
| InChIKey | NSVWUVHMXGUKDY-SEYXRHQNSA-N |
| XLogP | 1.57 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine?
The IUPAC name of 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine (CID 129059279) is 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine.
What is the SMILES notation for 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine?
The canonical SMILES for 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine is [H]/N=C(/CC1CN=C(C)N1C)N1CCCCC1.
What is the InChIKey of 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine?
The InChIKey is NSVWUVHMXGUKDY-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H22N4/c1-10-14-9-11(15(10)2)8-12(13)16-6-4-3-5-7-16/h11,13H,3-9H2,1-2H3/b13-12-.
What are the key properties of 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine?
2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine has a molecular weight of 222.34 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethyl-4,5-dihydroimidazol-4-yl)-1-piperidin-1-ylethanimine is sourced from PubChem (CID 129059279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).