C28H28Cl2F2N4O3 — CID 129059556
6-[[(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]pyridine-3-carboxylic acid (PubChem CID 129059556) has the molecular formula C28H28Cl2F2N4O3 and a molecular weight of 577.46 g/mol. Its IUPAC name is 6-[[(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 6-[[(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 129059556 |
| Molecular Formula | C28H28Cl2F2N4O3 |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 6-[[(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Nc2ccc(C(=O)O)cn2)[C@H](c2cccc(Cl)c2F)[C@@]1(N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C28H28Cl2F2N4O3/c1-27(2,3)12-20-28(33,17-9-8-15(29)11-19(17)31)22(16-5-4-6-18(30)23(16)32)24(35-20)25(37)36-21-10-7-14(13-34-21)26(38)39/h4-11,13,20,22,24,35H,12,33H2,1-3H3,(H,38,39)(H,34,36,37)/t20-,22-,24+,28+/m0/s1 |
| InChIKey | ZICRIPVGOAKEIP-VAEJZQHYSA-N |
| XLogP | 5.72 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |