C17H24ClFN2 — CID 129059617
4-[(2Z,4Z)-1-chloro-2-fluorohepta-2,4,6-trien-3-yl]-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile (PubChem CID 129059617) has the molecular formula C17H24ClFN2 and a molecular weight of 310.84 g/mol. Its IUPAC name is 4-[(2Z,4Z)-1-chloro-2-fluorohepta-2,4,6-trien-3-yl]-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile.
| Compound Name | 4-[(2Z,4Z)-1-chloro-2-fluorohepta-2,4,6-trien-3-yl]-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 129059617 |
| Molecular Formula | C17H24ClFN2 |
| Molecular Weight | 310.84 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 4-[(2Z,4Z)-1-chloro-2-fluorohepta-2,4,6-trien-3-yl]-2-(2,2-dimethylpropyl)pyrrolidine-3-carbonitrile |
| SMILES | C=C/C=C\C(=C(\F)CCl)C1CNC(CC(C)(C)C)C1C#N |
| InChI | InChI=1S/C17H24ClFN2/c1-5-6-7-12(15(19)9-18)14-11-21-16(13(14)10-20)8-17(2,3)4/h5-7,13-14,16,21H,1,8-9,11H2,2-4H3/b7-6-,15-12- |
| InChIKey | OPOOFMJXCOGDJI-OKYPJBATSA-N |
| XLogP | 4.35 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|