C20H15Cl2F6N3 — CID 129059775
N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-N-methyl-2-(trifluoromethyl)anilino]-N-methylidenemethanimidamide (PubChem CID 129059775) has the molecular formula C20H15Cl2F6N3 and a molecular weight of 482.26 g/mol. Its IUPAC name is N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-N-methyl-2-(trifluoromethyl)anilino]-N-methylidenemethanimidamide.
| Compound Name | N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-N-methyl-2-(trifluoromethyl)anilino]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 129059775 |
| Molecular Formula | C20H15Cl2F6N3 |
| Molecular Weight | 482.26 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | N'-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-N-methyl-2-(trifluoromethyl)anilino]-N-methylidenemethanimidamide |
| SMILES | C=N/C=N\N(C)c1ccc(/C=C/C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C20H15Cl2F6N3/c1-29-11-30-31(2)18-6-4-12(7-17(18)20(26,27)28)3-5-16(19(23,24)25)13-8-14(21)10-15(22)9-13/h3-11,16H,1H2,2H3/b5-3+,30-11- |
| InChIKey | KHGUBGHNUMTHQI-GQXNZLBCSA-N |
| XLogP | 7.45 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.26 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|