About (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane
(3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane (PubChem CID 129059983) has the molecular formula C10H19Cl
and a molecular weight of 174.71 g/mol. Its IUPAC name is (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane.
Molecular Properties
| Compound Name | (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane |
| PubChem CID | 129059983 |
| Molecular Formula | C10H19Cl |
| Molecular Weight | 174.71 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane |
| SMILES | CCC1C(Cl)CC(C)C[C@H]1C |
| InChI | InChI=1S/C10H19Cl/c1-4-9-8(3)5-7(2)6-10(9)11/h7-10H,4-6H2,1-3H3/t7?,8-,9?,10?/m1/s1 |
| InChIKey | KNYLHEWWPNQDJV-FVKBGGDRSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane?
The IUPAC name of (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane (CID 129059983) is (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane.
What is the SMILES notation for (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane?
The canonical SMILES for (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane is CCC1C(Cl)CC(C)C[C@H]1C.
What is the InChIKey of (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane?
The InChIKey is KNYLHEWWPNQDJV-FVKBGGDRSA-N. The full InChI is InChI=1S/C10H19Cl/c1-4-9-8(3)5-7(2)6-10(9)11/h7-10H,4-6H2,1-3H3/t7?,8-,9?,10?/m1/s1.
What are the key properties of (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane?
(3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane has a molecular weight of 174.71 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-chloro-2-ethyl-3,5-dimethylcyclohexane is sourced from PubChem (CID 129059983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).