C14H23N3 — CID 129059995
(E)-1-N,2-N-dimethyl-1-N'-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]but-2-ene-1,1,2-triamine (PubChem CID 129059995) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (E)-1-N,2-N-dimethyl-1-N'-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]but-2-ene-1,1,2-triamine.
| Compound Name | (E)-1-N,2-N-dimethyl-1-N'-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]but-2-ene-1,1,2-triamine |
|---|---|
| PubChem CID | 129059995 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (E)-1-N,2-N-dimethyl-1-N'-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]but-2-ene-1,1,2-triamine |
| SMILES | C=C/C=C\C(=C)C(=C)NC(NC)/C(=C\C)NC |
| InChI | InChI=1S/C14H23N3/c1-7-9-10-11(3)12(4)17-14(16-6)13(8-2)15-5/h7-10,14-17H,1,3-4H2,2,5-6H3/b10-9-,13-8+ |
| InChIKey | QJPJLEMGLNYYCX-ZSEITYQVSA-N |
| XLogP | 2.06 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|