C14H23NO — CID 129060034
(2Z,4E,6E)-1-(1-methylpiperidin-4-yl)octa-2,4,6-trien-4-ol (PubChem CID 129060034) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (2Z,4E,6E)-1-(1-methylpiperidin-4-yl)octa-2,4,6-trien-4-ol.
| Compound Name | (2Z,4E,6E)-1-(1-methylpiperidin-4-yl)octa-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 129060034 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2Z,4E,6E)-1-(1-methylpiperidin-4-yl)octa-2,4,6-trien-4-ol |
| SMILES | C/C=C/C=C(O)\C=C/CC1CCN(C)CC1 |
| InChI | InChI=1S/C14H23NO/c1-3-4-7-14(16)8-5-6-13-9-11-15(2)12-10-13/h3-5,7-8,13,16H,6,9-12H2,1-2H3/b4-3+,8-5-,14-7+ |
| InChIKey | ODIWURTZXYXOCO-ZROUSKLZSA-N |
| XLogP | 3.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|