C26H41N — CID 129060052
(2Z,7Z)-4,5,6,10-tetramethyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-5-prop-1-enylundeca-2,7,9-trien-3-amine (PubChem CID 129060052) has the molecular formula C26H41N and a molecular weight of 367.62 g/mol. Its IUPAC name is (2Z,7Z)-4,5,6,10-tetramethyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-5-prop-1-enylundeca-2,7,9-trien-3-amine.
| Compound Name | (2Z,7Z)-4,5,6,10-tetramethyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-5-prop-1-enylundeca-2,7,9-trien-3-amine |
|---|---|
| PubChem CID | 129060052 |
| Molecular Formula | C26H41N |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | (2Z,7Z)-4,5,6,10-tetramethyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]-5-prop-1-enylundeca-2,7,9-trien-3-amine |
| SMILES | C=C/C=C\C=C(/C)CN/C(=C\C)C(C)C(C)(C=CC)C(C)/C=C\C=C(C)C |
| InChI | InChI=1S/C26H41N/c1-10-13-14-17-22(6)20-27-25(12-3)24(8)26(9,19-11-2)23(7)18-15-16-21(4)5/h10-19,23-24,27H,1,20H2,2-9H3/b14-13-,18-15-,19-11?,22-17+,25-12- |
| InChIKey | LHSUXUZHQBPVPX-WFCHVFLJSA-N |
| XLogP | 7.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|